C15H13N3OS — CID 166127952
2-(8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl)phenol (PubChem CID 166127952) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-(8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl)phenol.
| Compound Name | 2-(8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl)phenol |
|---|---|
| PubChem CID | 166127952 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl)phenol |
| SMILES | Oc1ccccc1-c1cc2c3c(sc2nn1)CCNC3 |
| InChI | InChI=1S/C15H13N3OS/c19-13-4-2-1-3-9(13)12-7-10-11-8-16-6-5-14(11)20-15(10)18-17-12/h1-4,7,16,19H,5-6,8H2 |
| InChIKey | IRSRHGJTPOVVST-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |