About 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine
2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine (PubChem CID 166128008) has the molecular formula C8H8ClN3S
and a molecular weight of 213.69 g/mol. Its IUPAC name is 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine |
| PubChem CID | 166128008 |
| Molecular Formula | C8H8ClN3S |
| Molecular Weight | 213.69 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine |
| SMILES | NCCc1cc2cc(Cl)nnc2s1 |
| InChI | InChI=1S/C8H8ClN3S/c9-7-4-5-3-6(1-2-10)13-8(5)12-11-7/h3-4H,1-2,10H2 |
| InChIKey | NXZWFMAZABDWLE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine?
The IUPAC name of 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine (CID 166128008) is 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine.
What is the SMILES notation for 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine?
The canonical SMILES for 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine is NCCc1cc2cc(Cl)nnc2s1.
What is the InChIKey of 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine?
The InChIKey is NXZWFMAZABDWLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3S/c9-7-4-5-3-6(1-2-10)13-8(5)12-11-7/h3-4H,1-2,10H2.
What are the key properties of 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine?
2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine has a molecular weight of 213.69 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorothieno[2,3-c]pyridazin-6-yl)ethanamine is sourced from PubChem (CID 166128008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).