C14H16ClN3O2S — CID 166128025
tert-butyl 12-chloro-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4-carboxylate (PubChem CID 166128025) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is tert-butyl 12-chloro-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4-carboxylate.
| Compound Name | tert-butyl 12-chloro-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 166128025 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | tert-butyl 12-chloro-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2sc3nnc(Cl)cc3c2C1 |
| InChI | InChI=1S/C14H16ClN3O2S/c1-14(2,3)20-13(19)18-5-4-10-9(7-18)8-6-11(15)16-17-12(8)21-10/h6H,4-5,7H2,1-3H3 |
| InChIKey | IZZSCMMQYNSYCW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |