About 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile
3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile (PubChem CID 166128165) has the molecular formula C10H7BClN3S
and a molecular weight of 247.52 g/mol. Its IUPAC name is 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile.
Molecular Properties
| Compound Name | 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile |
| PubChem CID | 166128165 |
| Molecular Formula | C10H7BClN3S |
| Molecular Weight | 247.52 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile |
| SMILES | N#CB1CC(c2cc3nnc(Cl)cc3s2)C1 |
| InChI | InChI=1S/C10H7BClN3S/c12-10-2-9-7(14-15-10)1-8(16-9)6-3-11(4-6)5-13/h1-2,6H,3-4H2 |
| InChIKey | RUZWOGFNXJKXNQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile?
The IUPAC name of 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile (CID 166128165) is 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile.
What is the SMILES notation for 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile?
The canonical SMILES for 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile is N#CB1CC(c2cc3nnc(Cl)cc3s2)C1.
What is the InChIKey of 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile?
The InChIKey is RUZWOGFNXJKXNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BClN3S/c12-10-2-9-7(14-15-10)1-8(16-9)6-3-11(4-6)5-13/h1-2,6H,3-4H2.
What are the key properties of 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile?
3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile has a molecular weight of 247.52 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorothieno[3,2-c]pyridazin-6-yl)boretane-1-carbonitrile is sourced from PubChem (CID 166128165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).