C24H22N4O2 — CID 166128347
2-(cyclopentylamino)-4-(3-phenylpyrrolo[2,3-b]pyrazin-5-yl)benzoic acid (PubChem CID 166128347) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-(cyclopentylamino)-4-(3-phenylpyrrolo[2,3-b]pyrazin-5-yl)benzoic acid.
| Compound Name | 2-(cyclopentylamino)-4-(3-phenylpyrrolo[2,3-b]pyrazin-5-yl)benzoic acid |
|---|---|
| PubChem CID | 166128347 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-(cyclopentylamino)-4-(3-phenylpyrrolo[2,3-b]pyrazin-5-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-n2ccc3ncc(-c4ccccc4)nc32)cc1NC1CCCC1 |
| InChI | InChI=1S/C24H22N4O2/c29-24(30)19-11-10-18(14-21(19)26-17-8-4-5-9-17)28-13-12-20-23(28)27-22(15-25-20)16-6-2-1-3-7-16/h1-3,6-7,10-15,17,26H,4-5,8-9H2,(H,29,30) |
| InChIKey | CPPUVAXNSMUKQE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |