About 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid
2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid (PubChem CID 166128357) has the molecular formula C24H18Cl2FN3O2
and a molecular weight of 470.33 g/mol. Its IUPAC name is 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid.
Molecular Properties
| Compound Name | 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid |
| PubChem CID | 166128357 |
| Molecular Formula | C24H18Cl2FN3O2 |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c(F)cnc3cn(-c4cc(Cl)cc(Cl)c4)nc23)cc1C1CCCC1 |
| InChI | InChI=1S/C24H18Cl2FN3O2/c25-15-8-16(26)10-17(9-15)30-12-21-23(29-30)22(20(27)11-28-21)14-5-6-18(24(31)32)19(7-14)13-3-1-2-4-13/h5-13H,1-4H2,(H,31,32) |
| InChIKey | DGKKBQLIBRAFBQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid?
The IUPAC name of 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid (CID 166128357) is 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid.
What is the SMILES notation for 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid?
The canonical SMILES for 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid is O=C(O)c1ccc(-c2c(F)cnc3cn(-c4cc(Cl)cc(Cl)c4)nc23)cc1C1CCCC1.
What is the InChIKey of 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid?
The InChIKey is DGKKBQLIBRAFBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18Cl2FN3O2/c25-15-8-16(26)10-17(9-15)30-12-21-23(29-30)22(20(27)11-28-21)14-5-6-18(24(31)32)19(7-14)13-3-1-2-4-13/h5-13H,1-4H2,(H,31,32).
What are the key properties of 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid?
2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid has a molecular weight of 470.33 g/mol, XLogP of 6.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-4-[2-(3,5-dichlorophenyl)-6-fluoropyrazolo[4,3-b]pyridin-7-yl]benzoic acid is sourced from PubChem (CID 166128357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).