C16H18ClN7 — CID 166128462
N-[5-chloro-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1H-indazol-3-amine (PubChem CID 166128462) has the molecular formula C16H18ClN7 and a molecular weight of 343.82 g/mol. Its IUPAC name is N-[5-chloro-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1H-indazol-3-amine.
| Compound Name | N-[5-chloro-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1H-indazol-3-amine |
|---|---|
| PubChem CID | 166128462 |
| Molecular Formula | C16H18ClN7 |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[5-chloro-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1H-indazol-3-amine |
| SMILES | CN1CCN(c2ncnc(Nc3n[nH]c4ccccc34)c2Cl)CC1 |
| InChI | InChI=1S/C16H18ClN7/c1-23-6-8-24(9-7-23)16-13(17)15(18-10-19-16)20-14-11-4-2-3-5-12(11)21-22-14/h2-5,10H,6-9H2,1H3,(H2,18,19,20,21,22) |
| InChIKey | QLKKYEAYFJROJD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |