C25H28ClN5O2 — CID 166128601
N-(5-chloro-2-methyl-4-pyridinyl)-1H-indazol-3-amine;cyclopropanecarbaldehyde;4-methoxy-N-methylaniline (PubChem CID 166128601) has the molecular formula C25H28ClN5O2 and a molecular weight of 465.99 g/mol. Its IUPAC name is N-(5-chloro-2-methyl-4-pyridinyl)-1H-indazol-3-amine;cyclopropanecarbaldehyde;4-methoxy-N-methylaniline.
| Compound Name | N-(5-chloro-2-methyl-4-pyridinyl)-1H-indazol-3-amine;cyclopropanecarbaldehyde;4-methoxy-N-methylaniline |
|---|---|
| PubChem CID | 166128601 |
| Molecular Formula | C25H28ClN5O2 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-(5-chloro-2-methyl-4-pyridinyl)-1H-indazol-3-amine;cyclopropanecarbaldehyde;4-methoxy-N-methylaniline |
| SMILES | CNc1ccc(OC)cc1.Cc1cc(Nc2n[nH]c3ccccc23)c(Cl)cn1.O=CC1CC1 |
| InChI | InChI=1S/C13H11ClN4.C8H11NO.C4H6O/c1-8-6-12(10(14)7-15-8)16-13-9-4-2-3-5-11(9)17-18-13;1-9-7-3-5-8(10-2)6-4-7;5-3-4-1-2-4/h2-7H,1H3,(H2,15,16,17,18);3-6,9H,1-2H3;3-4H,1-2H2 |
| InChIKey | WGHAHIXAWNVTBC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|