C30H46N2O — CID 166129799
ethane;6-[(3Z,5Z)-3-ethenylocta-3,5,7-trienyl]-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 166129799) has the molecular formula C30H46N2O and a molecular weight of 450.71 g/mol. Its IUPAC name is ethane;6-[(3Z,5Z)-3-ethenylocta-3,5,7-trienyl]-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | ethane;6-[(3Z,5Z)-3-ethenylocta-3,5,7-trienyl]-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 166129799 |
| Molecular Formula | C30H46N2O |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.36 |
| IUPAC Name | ethane;6-[(3Z,5Z)-3-ethenylocta-3,5,7-trienyl]-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | C=C/C=C\C=C(/C=C)CCN1CCC2C(CCC(=O)N2C(/C=C\C=C)=C/C=C)C1.CC.CC |
| InChI | InChI=1S/C26H34N2O.2C2H6/c1-5-9-11-13-22(8-4)17-19-27-20-18-25-23(21-27)15-16-26(29)28(25)24(12-7-3)14-10-6-2;2*1-2/h5-14,23,25H,1-4,15-21H2;2*1-2H3/b11-9-,14-10-,22-13+,24-12+;; |
| InChIKey | AANMFPZUZILDDP-ARWSTHMUSA-N |
| XLogP | 7.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|