C29H48N2O — CID 166129815
ethane;1-[2-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-1,3,4,4a,8,9,10,10a-octahydrobenzo[b][1,6]naphthyridin-5-yl]butan-1-one (PubChem CID 166129815) has the molecular formula C29H48N2O and a molecular weight of 440.72 g/mol. Its IUPAC name is ethane;1-[2-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-1,3,4,4a,8,9,10,10a-octahydrobenzo[b][1,6]naphthyridin-5-yl]butan-1-one.
| Compound Name | ethane;1-[2-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-1,3,4,4a,8,9,10,10a-octahydrobenzo[b][1,6]naphthyridin-5-yl]butan-1-one |
|---|---|
| PubChem CID | 166129815 |
| Molecular Formula | C29H48N2O |
| Molecular Weight | 440.72 g/mol |
| Exact Mass | 440.38 |
| IUPAC Name | ethane;1-[2-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-1,3,4,4a,8,9,10,10a-octahydrobenzo[b][1,6]naphthyridin-5-yl]butan-1-one |
| SMILES | C=C/C(=C\C=C/C)CCN1CCC2C(CC3=C(C=CCC3)N2C(=O)CCC)C1.CC.CC |
| InChI | InChI=1S/C25H36N2O.2C2H6/c1-4-7-11-20(6-3)14-16-26-17-15-24-22(19-26)18-21-12-8-9-13-23(21)27(24)25(28)10-5-2;2*1-2/h4,6-7,9,11,13,22,24H,3,5,8,10,12,14-19H2,1-2H3;2*1-2H3/b7-4-,20-11+;; |
| InChIKey | QZHHBBUYVNBNEW-SOFSCAQDSA-N |
| XLogP | 7.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.72 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|