C18H26F3NO — CID 166129889
4-cyclopropyl-2-[(Z)-2-ethenyl-1,1,3-trifluoro-5-methyl-4-methylidenehept-2-enyl]morpholine (PubChem CID 166129889) has the molecular formula C18H26F3NO and a molecular weight of 329.41 g/mol. Its IUPAC name is 4-cyclopropyl-2-[(Z)-2-ethenyl-1,1,3-trifluoro-5-methyl-4-methylidenehept-2-enyl]morpholine.
| Compound Name | 4-cyclopropyl-2-[(Z)-2-ethenyl-1,1,3-trifluoro-5-methyl-4-methylidenehept-2-enyl]morpholine |
|---|---|
| PubChem CID | 166129889 |
| Molecular Formula | C18H26F3NO |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 4-cyclopropyl-2-[(Z)-2-ethenyl-1,1,3-trifluoro-5-methyl-4-methylidenehept-2-enyl]morpholine |
| SMILES | C=C/C(=C(/F)C(=C)C(C)CC)C(F)(F)C1CN(C2CC2)CCO1 |
| InChI | InChI=1S/C18H26F3NO/c1-5-12(3)13(4)17(19)15(6-2)18(20,21)16-11-22(9-10-23-16)14-7-8-14/h6,12,14,16H,2,4-5,7-11H2,1,3H3/b17-15- |
| InChIKey | FLMVNXHNDWEMKJ-ICFOKQHNSA-N |
| XLogP | 4.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|