About ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile
ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile (PubChem CID 166129940) has the molecular formula C12H23NOS
and a molecular weight of 229.39 g/mol. Its IUPAC name is ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile.
Molecular Properties
| Compound Name | ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile |
| PubChem CID | 166129940 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile |
| SMILES | CC.CC.CC1(C#N)CC2(CS(=O)C2)C1 |
| InChI | InChI=1S/C8H11NOS.2C2H6/c1-7(4-9)2-8(3-7)5-11(10)6-8;2*1-2/h2-3,5-6H2,1H3;2*1-2H3 |
| InChIKey | HHMCJRGVACIBGP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile?
The IUPAC name of ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile (CID 166129940) is ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile.
What is the SMILES notation for ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile?
The canonical SMILES for ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile is CC.CC.CC1(C#N)CC2(CS(=O)C2)C1.
What is the InChIKey of ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile?
The InChIKey is HHMCJRGVACIBGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NOS.2C2H6/c1-7(4-9)2-8(3-7)5-11(10)6-8;2*1-2/h2-3,5-6H2,1H3;2*1-2H3.
What are the key properties of ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile?
ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile has a molecular weight of 229.39 g/mol, XLogP of 3.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methyl-2-oxo-2λ4-thiaspiro[3.3]heptane-6-carbonitrile is sourced from PubChem (CID 166129940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).