C22H25NO3S — CID 166130338
N-[(5-phenylthiophen-2-yl)methyl]-2-(2,4,5-trimethoxyphenyl)ethanamine (PubChem CID 166130338) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is N-[(5-phenylthiophen-2-yl)methyl]-2-(2,4,5-trimethoxyphenyl)ethanamine.
| Compound Name | N-[(5-phenylthiophen-2-yl)methyl]-2-(2,4,5-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 166130338 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[(5-phenylthiophen-2-yl)methyl]-2-(2,4,5-trimethoxyphenyl)ethanamine |
| SMILES | COc1cc(OC)c(OC)cc1CCNCc1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C22H25NO3S/c1-24-19-14-21(26-3)20(25-2)13-17(19)11-12-23-15-18-9-10-22(27-18)16-7-5-4-6-8-16/h4-10,13-14,23H,11-12,15H2,1-3H3 |
| InChIKey | TYOPGSVJPGTVSI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|