C23H26ClN5O2 — CID 166131036
N-[2-chloro-4-[5-[hydroxy-[2-(1H-pyrazol-4-yl)ethylamino]methyl]-2-pyridinyl]phenyl]-N-(cyclopropylmethyl)acetamide (PubChem CID 166131036) has the molecular formula C23H26ClN5O2 and a molecular weight of 439.95 g/mol. Its IUPAC name is N-[2-chloro-4-[5-[hydroxy-[2-(1H-pyrazol-4-yl)ethylamino]methyl]-2-pyridinyl]phenyl]-N-(cyclopropylmethyl)acetamide.
| Compound Name | N-[2-chloro-4-[5-[hydroxy-[2-(1H-pyrazol-4-yl)ethylamino]methyl]-2-pyridinyl]phenyl]-N-(cyclopropylmethyl)acetamide |
|---|---|
| PubChem CID | 166131036 |
| Molecular Formula | C23H26ClN5O2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-[2-chloro-4-[5-[hydroxy-[2-(1H-pyrazol-4-yl)ethylamino]methyl]-2-pyridinyl]phenyl]-N-(cyclopropylmethyl)acetamide |
| SMILES | CC(=O)N(CC1CC1)c1ccc(-c2ccc(C(O)NCCc3cn[nH]c3)cn2)cc1Cl |
| InChI | InChI=1S/C23H26ClN5O2/c1-15(30)29(14-16-2-3-16)22-7-5-18(10-20(22)24)21-6-4-19(13-26-21)23(31)25-9-8-17-11-27-28-12-17/h4-7,10-13,16,23,25,31H,2-3,8-9,14H2,1H3,(H,27,28) |
| InChIKey | UKVBRGMNZVCIPV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|