C26H32F3N5O2 — CID 166131198
N-(cyclopropylmethyl)-N-[4-(5-formyl-2-pyridinyl)-2-(trifluoromethyl)phenyl]acetamide;(Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine (PubChem CID 166131198) has the molecular formula C26H32F3N5O2 and a molecular weight of 503.57 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[4-(5-formyl-2-pyridinyl)-2-(trifluoromethyl)phenyl]acetamide;(Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine.
| Compound Name | N-(cyclopropylmethyl)-N-[4-(5-formyl-2-pyridinyl)-2-(trifluoromethyl)phenyl]acetamide;(Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine |
|---|---|
| PubChem CID | 166131198 |
| Molecular Formula | C26H32F3N5O2 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[4-(5-formyl-2-pyridinyl)-2-(trifluoromethyl)phenyl]acetamide;(Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine |
| SMILES | CC(=O)N(CC1CC1)c1ccc(-c2ccc(C=O)cn2)cc1C(F)(F)F.[H]/N=C/C(=C\N)CCCNC |
| InChI | InChI=1S/C19H17F3N2O2.C7H15N3/c1-12(26)24(10-13-2-3-13)18-7-5-15(8-16(18)19(20,21)22)17-6-4-14(11-25)9-23-17;1-10-4-2-3-7(5-8)6-9/h4-9,11,13H,2-3,10H2,1H3;5-6,8,10H,2-4,9H2,1H3/b;7-6-,8-5+ |
| InChIKey | KSVUWZXLXMTJEE-NDGWRNPXSA-N |
| XLogP | 4.82 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|