About (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine
(Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine (PubChem CID 166131199) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine.
Molecular Properties
| Compound Name | (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine |
| PubChem CID | 166131199 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine |
| SMILES | [H]/N=C/C(=C\N)CCCNC |
| InChI | InChI=1S/C7H15N3/c1-10-4-2-3-7(5-8)6-9/h5-6,8,10H,2-4,9H2,1H3/b7-6-,8-5+ |
| InChIKey | HHXHDYQBYWAZMB-WNXMRAAYSA-N |
| XLogP | 0.48 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine?
The IUPAC name of (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine (CID 166131199) is (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine.
What is the SMILES notation for (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine?
The canonical SMILES for (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine is [H]/N=C/C(=C\N)CCCNC.
What is the InChIKey of (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine?
The InChIKey is HHXHDYQBYWAZMB-WNXMRAAYSA-N. The full InChI is InChI=1S/C7H15N3/c1-10-4-2-3-7(5-8)6-9/h5-6,8,10H,2-4,9H2,1H3/b7-6-,8-5+.
What are the key properties of (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine?
(Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine has a molecular weight of 141.22 g/mol, XLogP of 0.48, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-methanimidoyl-N'-methylpent-1-ene-1,5-diamine is sourced from PubChem (CID 166131199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).