C28H34N2 — CID 166131614
N'-ethenyl-2-methyl-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]benzenecarboximidamide;1-methyl-2-[(Z)-prop-1-enyl]benzene (PubChem CID 166131614) has the molecular formula C28H34N2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N'-ethenyl-2-methyl-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]benzenecarboximidamide;1-methyl-2-[(Z)-prop-1-enyl]benzene.
| Compound Name | N'-ethenyl-2-methyl-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]benzenecarboximidamide;1-methyl-2-[(Z)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 166131614 |
| Molecular Formula | C28H34N2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N'-ethenyl-2-methyl-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]benzenecarboximidamide;1-methyl-2-[(Z)-prop-1-enyl]benzene |
| SMILES | C/C=C\c1ccccc1C.C=C/N=C(/NC(/C=C\C(=C)C)=C/C)c1ccccc1C |
| InChI | InChI=1S/C18H22N2.C10H12/c1-6-16(13-12-14(3)4)20-18(19-7-2)17-11-9-8-10-15(17)5;1-3-6-10-8-5-4-7-9(10)2/h6-13H,2-3H2,1,4-5H3,(H,19,20);3-8H,1-2H3/b13-12-,16-6+;6-3- |
| InChIKey | JEFGGQULDZFXHG-LQPJACEYSA-N |
| XLogP | 7.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|