C25H33NO2S — CID 166131813
5a,11a-dimethyl-2-(4-methylphenyl)sulfinyl-3,4,5,6,8,9,9a,9b,10,11-decahydro-1H-naphtho[2,1-e]isoindol-7-one (PubChem CID 166131813) has the molecular formula C25H33NO2S and a molecular weight of 411.61 g/mol. Its IUPAC name is 5a,11a-dimethyl-2-(4-methylphenyl)sulfinyl-3,4,5,6,8,9,9a,9b,10,11-decahydro-1H-naphtho[2,1-e]isoindol-7-one.
| Compound Name | 5a,11a-dimethyl-2-(4-methylphenyl)sulfinyl-3,4,5,6,8,9,9a,9b,10,11-decahydro-1H-naphtho[2,1-e]isoindol-7-one |
|---|---|
| PubChem CID | 166131813 |
| Molecular Formula | C25H33NO2S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 5a,11a-dimethyl-2-(4-methylphenyl)sulfinyl-3,4,5,6,8,9,9a,9b,10,11-decahydro-1H-naphtho[2,1-e]isoindol-7-one |
| SMILES | Cc1ccc(S(=O)N2CC3=C4CCC5(C)CC(=O)CCC5C4CCC3(C)C2)cc1 |
| InChI | InChI=1S/C25H33NO2S/c1-17-4-7-19(8-5-17)29(28)26-15-23-21-10-12-24(2)14-18(27)6-9-22(24)20(21)11-13-25(23,3)16-26/h4-5,7-8,20,22H,6,9-16H2,1-3H3 |
| InChIKey | UIKXQSUCCAMMGA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|