About 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine
2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine (PubChem CID 166132402) has the molecular formula C22H17ClF2N2O
and a molecular weight of 398.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine |
| PubChem CID | 166132402 |
| Molecular Formula | C22H17ClF2N2O |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine |
| SMILES | Cc1cc(C2=NC(C)(c3ccc(Cl)cc3)Oc3ccccc32)cnc1C(F)F |
| InChI | InChI=1S/C22H17ClF2N2O/c1-13-11-14(12-26-19(13)21(24)25)20-17-5-3-4-6-18(17)28-22(2,27-20)15-7-9-16(23)10-8-15/h3-12,21H,1-2H3 |
| InChIKey | SONTVNCKJBJDQZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine?
The IUPAC name of 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine (CID 166132402) is 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine.
What is the SMILES notation for 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine?
The canonical SMILES for 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine is Cc1cc(C2=NC(C)(c3ccc(Cl)cc3)Oc3ccccc32)cnc1C(F)F.
What is the InChIKey of 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine?
The InChIKey is SONTVNCKJBJDQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17ClF2N2O/c1-13-11-14(12-26-19(13)21(24)25)20-17-5-3-4-6-18(17)28-22(2,27-20)15-7-9-16(23)10-8-15/h3-12,21H,1-2H3.
What are the key properties of 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine?
2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine has a molecular weight of 398.84 g/mol, XLogP of 6.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-4-[6-(difluoromethyl)-5-methyl-3-pyridinyl]-2-methyl-1,3-benzoxazine is sourced from PubChem (CID 166132402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).