2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid

C9H4ClF5O3 — CID 166132507

IUPAC2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid
SMILESO=C(O)C(F)(F)c1ccc(OC(F)(F)F)cc1Cl
InChIInChI=1S/C9H4ClF5O3/c10-6-3-4(18-9(13,14)15)1-2-5(6)8(11,12)7(16)17/h1-3H,(H,16,17)
InChIKeyBHJXLVOWWOGVAE-UHFFFAOYSA-N
MW290.57 g/mol
LogP3.41
Rot. Bonds3

About 2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid

2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid (PubChem CID 166132507) has the molecular formula C9H4ClF5O3 and a molecular weight of 290.57 g/mol. Its IUPAC name is 2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid.

Molecular Properties

Compound Name2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid
PubChem CID166132507
Molecular FormulaC9H4ClF5O3
Molecular Weight290.57 g/mol
Exact Mass289.98
IUPAC Name2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid
SMILESO=C(O)C(F)(F)c1ccc(OC(F)(F)F)cc1Cl
InChIInChI=1S/C9H4ClF5O3/c10-6-3-4(18-9(13,14)15)1-2-5(6)8(11,12)7(16)17/h1-3H,(H,16,17)
InChIKeyBHJXLVOWWOGVAE-UHFFFAOYSA-N
XLogP3.41
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.57
LogP ≤ 53.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid?
The IUPAC name of 2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid (CID 166132507) is 2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid.
What is the SMILES notation for 2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid?
The canonical SMILES for 2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid is O=C(O)C(F)(F)c1ccc(OC(F)(F)F)cc1Cl.
What is the InChIKey of 2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid?
The InChIKey is BHJXLVOWWOGVAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClF5O3/c10-6-3-4(18-9(13,14)15)1-2-5(6)8(11,12)7(16)17/h1-3H,(H,16,17).
What are the key properties of 2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid?
2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid has a molecular weight of 290.57 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid is sourced from PubChem (CID 166132507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).