About ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide
ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide (PubChem CID 166132621) has the molecular formula C16H24N2O4
and a molecular weight of 308.38 g/mol. Its IUPAC name is ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide.
Molecular Properties
| Compound Name | ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide |
| PubChem CID | 166132621 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide |
| SMILES | C/C=C\C1=C(C)C(=O)N(C(CCC=O)C(=O)NC)C1=O.CC |
| InChI | InChI=1S/C14H18N2O4.C2H6/c1-4-6-10-9(2)13(19)16(14(10)20)11(7-5-8-17)12(18)15-3;1-2/h4,6,8,11H,5,7H2,1-3H3,(H,15,18);1-2H3/b6-4-; |
| InChIKey | HQNVZBWGOCCZFU-YHSAGPEESA-N |
| XLogP | 1.37 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide?
The IUPAC name of ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide (CID 166132621) is ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide.
What is the SMILES notation for ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide?
The canonical SMILES for ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide is C/C=C\C1=C(C)C(=O)N(C(CCC=O)C(=O)NC)C1=O.CC.
What is the InChIKey of ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide?
The InChIKey is HQNVZBWGOCCZFU-YHSAGPEESA-N. The full InChI is InChI=1S/C14H18N2O4.C2H6/c1-4-6-10-9(2)13(19)16(14(10)20)11(7-5-8-17)12(18)15-3;1-2/h4,6,8,11H,5,7H2,1-3H3,(H,15,18);1-2H3/b6-4-;.
What are the key properties of ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide?
ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide has a molecular weight of 308.38 g/mol, XLogP of 1.37, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-2-[3-methyl-2,5-dioxo-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-5-oxopentanamide is sourced from PubChem (CID 166132621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).