C21H29N5O3 — CID 16613316
methyl 2,4-dimethyl-5-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]-1H-pyrrole-3-carboxylate (PubChem CID 16613316) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is methyl 2,4-dimethyl-5-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 2,4-dimethyl-5-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 16613316 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | methyl 2,4-dimethyl-5-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(C(=O)N2CCCC(c3nnc4n3CCCCC4)C2)c1C |
| InChI | InChI=1S/C21H29N5O3/c1-13-17(21(28)29-3)14(2)22-18(13)20(27)25-10-7-8-15(12-25)19-24-23-16-9-5-4-6-11-26(16)19/h15,22H,4-12H2,1-3H3 |
| InChIKey | QRXUQPSLNPUIGF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |