About ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide
ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide (PubChem CID 166133181) has the molecular formula C25H29N3S
and a molecular weight of 403.60 g/mol. Its IUPAC name is ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide.
Molecular Properties
| Compound Name | ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide |
| PubChem CID | 166133181 |
| Molecular Formula | C25H29N3S |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide |
| SMILES | CC.CCc1cc(C)cc(-c2c[nH]c3ncc(-c4ccccc4)cc23)c1.NC=S |
| InChI | InChI=1S/C22H20N2.C2H6.CH3NS/c1-3-16-9-15(2)10-18(11-16)21-14-24-22-20(21)12-19(13-23-22)17-7-5-4-6-8-17;1-2;2-1-3/h4-14H,3H2,1-2H3,(H,23,24);1-2H3;1H,(H2,2,3) |
| InChIKey | HDSSMWOFOLXZIQ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide?
The IUPAC name of ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide (CID 166133181) is ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide.
What is the SMILES notation for ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide?
The canonical SMILES for ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide is CC.CCc1cc(C)cc(-c2c[nH]c3ncc(-c4ccccc4)cc23)c1.NC=S.
What is the InChIKey of ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide?
The InChIKey is HDSSMWOFOLXZIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2.C2H6.CH3NS/c1-3-16-9-15(2)10-18(11-16)21-14-24-22-20(21)12-19(13-23-22)17-7-5-4-6-8-17;1-2;2-1-3/h4-14H,3H2,1-2H3,(H,23,24);1-2H3;1H,(H2,2,3).
What are the key properties of ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide?
ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide has a molecular weight of 403.60 g/mol, XLogP of 6.70, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(3-ethyl-5-methylphenyl)-5-phenyl-1H-pyrrolo[2,3-b]pyridine;methanethioamide is sourced from PubChem (CID 166133181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).