About 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine
2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 166133254) has the molecular formula C8H8ClN3
and a molecular weight of 181.63 g/mol. Its IUPAC name is 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 166133254 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1cc2c(C)nc(Cl)nc2[nH]1 |
| InChI | InChI=1S/C8H8ClN3/c1-4-3-6-5(2)11-8(9)12-7(6)10-4/h3H,1-2H3,(H,10,11,12) |
| InChIKey | SERJPLXTYVKUFQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine (CID 166133254) is 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine is Cc1cc2c(C)nc(Cl)nc2[nH]1.
What is the InChIKey of 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is SERJPLXTYVKUFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3/c1-4-3-6-5(2)11-8(9)12-7(6)10-4/h3H,1-2H3,(H,10,11,12).
What are the key properties of 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine?
2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 181.63 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 166133254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).