C22H31N5O3 — CID 16613329
ethyl 2,4-dimethyl-5-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]-1H-pyrrole-3-carboxylate (PubChem CID 16613329) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 16613329 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | ethyl 2,4-dimethyl-5-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)N2CCCC(c3nnc4n3CCCCC4)C2)c1C |
| InChI | InChI=1S/C22H31N5O3/c1-4-30-22(29)18-14(2)19(23-15(18)3)21(28)26-11-8-9-16(13-26)20-25-24-17-10-6-5-7-12-27(17)20/h16,23H,4-13H2,1-3H3 |
| InChIKey | XTBYFAFOIGRKJK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |