C6H12O8S — CID 166133374
(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-methyloxane-2-sulfonic acid (PubChem CID 166133374) has the molecular formula C6H12O8S and a molecular weight of 244.22 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-methyloxane-2-sulfonic acid.
| Compound Name | (2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-methyloxane-2-sulfonic acid |
|---|---|
| PubChem CID | 166133374 |
| Molecular Formula | C6H12O8S |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-methyloxane-2-sulfonic acid |
| SMILES | C[C@H]1O[C@](O)(S(=O)(=O)O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O8S/c1-2-3(7)4(8)5(9)6(10,14-2)15(11,12)13/h2-5,7-10H,1H3,(H,11,12,13)/t2-,3-,4+,5-,6+/m1/s1 |
| InChIKey | HVHHHLYYYJLHRF-DVKNGEFBSA-N |
| XLogP | -2.98 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|