C47H39N5 — CID 166133624
2,3-ditert-butyl-1-(5,6-diphenyltriazin-4-yl)-4-phenylindolo[3,2-c]carbazole (PubChem CID 166133624) has the molecular formula C47H39N5 and a molecular weight of 673.86 g/mol. Its IUPAC name is 2,3-ditert-butyl-1-(5,6-diphenyltriazin-4-yl)-4-phenylindolo[3,2-c]carbazole.
| Compound Name | 2,3-ditert-butyl-1-(5,6-diphenyltriazin-4-yl)-4-phenylindolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 166133624 |
| Molecular Formula | C47H39N5 |
| Molecular Weight | 673.86 g/mol |
| Exact Mass | 673.32 |
| IUPAC Name | 2,3-ditert-butyl-1-(5,6-diphenyltriazin-4-yl)-4-phenylindolo[3,2-c]carbazole |
| SMILES | CC(C)(C)c1c(-c2ccccc2)c2c(c(-c3nnnc(-c4ccccc4)c3-c3ccccc3)c1C(C)(C)C)-c1c3c(ccc1=N2)=c1ccccc1=N3 |
| InChI | InChI=1S/C47H39N5/c1-46(2,3)40-35(28-18-10-7-11-19-28)44-38(37-34(49-44)27-26-32-31-24-16-17-25-33(31)48-43(32)37)39(41(40)47(4,5)6)45-36(29-20-12-8-13-21-29)42(50-52-51-45)30-22-14-9-15-23-30/h7-27H,1-6H3 |
| InChIKey | SGZIUSPMLSAGAQ-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.86 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |