C42H30N4 — CID 166133765
2-(2,3-dimethyl-9H-fluoren-1-yl)-1-(5,6-diphenyltriazin-4-yl)-9H-carbazole (PubChem CID 166133765) has the molecular formula C42H30N4 and a molecular weight of 590.73 g/mol. Its IUPAC name is 2-(2,3-dimethyl-9H-fluoren-1-yl)-1-(5,6-diphenyltriazin-4-yl)-9H-carbazole.
| Compound Name | 2-(2,3-dimethyl-9H-fluoren-1-yl)-1-(5,6-diphenyltriazin-4-yl)-9H-carbazole |
|---|---|
| PubChem CID | 166133765 |
| Molecular Formula | C42H30N4 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 2-(2,3-dimethyl-9H-fluoren-1-yl)-1-(5,6-diphenyltriazin-4-yl)-9H-carbazole |
| SMILES | Cc1cc2c(c(-c3ccc4c([nH]c5ccccc54)c3-c3nnnc(-c4ccccc4)c3-c3ccccc3)c1C)Cc1ccccc1-2 |
| InChI | InChI=1S/C42H30N4/c1-25-23-34-30-18-10-9-17-29(30)24-35(34)37(26(25)2)33-22-21-32-31-19-11-12-20-36(31)43-41(32)39(33)42-38(27-13-5-3-6-14-27)40(44-46-45-42)28-15-7-4-8-16-28/h3-23,43H,24H2,1-2H3 |
| InChIKey | FZUIZVKFOGVFSW-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |