C29H18N4S — CID 166134034
2-(5,6-diphenyltriazin-4-yl)-1H-[1]benzothiolo[2,3-g]indole (PubChem CID 166134034) has the molecular formula C29H18N4S and a molecular weight of 454.56 g/mol. Its IUPAC name is 2-(5,6-diphenyltriazin-4-yl)-1H-[1]benzothiolo[2,3-g]indole.
| Compound Name | 2-(5,6-diphenyltriazin-4-yl)-1H-[1]benzothiolo[2,3-g]indole |
|---|---|
| PubChem CID | 166134034 |
| Molecular Formula | C29H18N4S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 2-(5,6-diphenyltriazin-4-yl)-1H-[1]benzothiolo[2,3-g]indole |
| SMILES | c1ccc(-c2nnnc(-c3cc4ccc5sc6ccccc6c5c4[nH]3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H18N4S/c1-3-9-18(10-4-1)25-28(19-11-5-2-6-12-19)31-33-32-29(25)22-17-20-15-16-24-26(27(20)30-22)21-13-7-8-14-23(21)34-24/h1-17,30H |
| InChIKey | GWFWPINEFLQAML-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |