C45H41N3O — CID 166134096
4-[2,3-bis(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)-6-[2-(2-phenylphenyl)dibenzofuran-1-yl]phenyl]triazine (PubChem CID 166134096) has the molecular formula C45H41N3O and a molecular weight of 659.97 g/mol. Its IUPAC name is 4-[2,3-bis(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)-6-[2-(2-phenylphenyl)dibenzofuran-1-yl]phenyl]triazine.
| Compound Name | 4-[2,3-bis(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)-6-[2-(2-phenylphenyl)dibenzofuran-1-yl]phenyl]triazine |
|---|---|
| PubChem CID | 166134096 |
| Molecular Formula | C45H41N3O |
| Molecular Weight | 659.97 g/mol |
| Exact Mass | 659.45 |
| IUPAC Name | 4-[2,3-bis(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)-6-[2-(2-phenylphenyl)dibenzofuran-1-yl]phenyl]triazine |
| SMILES | [2H]C1C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])c1ccc(-c2c(-c3ccccc3-c3ccccc3)ccc3oc4ccccc4c23)c(-c2ccnnn2)c1C1([2H])C([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C45H41N3O/c1-4-14-30(15-5-1)33-20-10-11-21-35(33)36-26-27-41-45(37-22-12-13-23-40(37)49-41)43(36)38-25-24-34(31-16-6-2-7-17-31)42(32-18-8-3-9-19-32)44(38)39-28-29-46-48-47-39/h1,4-5,10-15,20-29,31-32H,2-3,6-9,16-19H2/i2D2,3D2,6D2,7D2,8D2,9D2,16D,17D2,18D,19D2,31D,32D |
| InChIKey | WWTFPCMEOOBTDW-AXZRIBQQSA-N |
| XLogP | 12.53 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.97 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |