C32H38BBrF3NO4 — CID 166136391
2-bromo-6-[[2-[3-[4-methyl-2-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]-4-(trifluoromethyl)phenyl]methoxy]pyridine (PubChem CID 166136391) has the molecular formula C32H38BBrF3NO4 and a molecular weight of 648.37 g/mol. Its IUPAC name is 2-bromo-6-[[2-[3-[4-methyl-2-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]-4-(trifluoromethyl)phenyl]methoxy]pyridine.
| Compound Name | 2-bromo-6-[[2-[3-[4-methyl-2-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]-4-(trifluoromethyl)phenyl]methoxy]pyridine |
|---|---|
| PubChem CID | 166136391 |
| Molecular Formula | C32H38BBrF3NO4 |
| Molecular Weight | 648.37 g/mol |
| Exact Mass | 647.20 |
| IUPAC Name | 2-bromo-6-[[2-[3-[4-methyl-2-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]-4-(trifluoromethyl)phenyl]methoxy]pyridine |
| SMILES | CCCc1cc(C)c(B2OC(C)(C)C(C)(C)O2)cc1OCCCc1cc(C(F)(F)F)ccc1COc1cccc(Br)n1 |
| InChI | InChI=1S/C32H38BBrF3NO4/c1-7-10-23-17-21(2)26(33-41-30(3,4)31(5,6)42-33)19-27(23)39-16-9-11-22-18-25(32(35,36)37)15-14-24(22)20-40-29-13-8-12-28(34)38-29/h8,12-15,17-19H,7,9-11,16,20H2,1-6H3 |
| InChIKey | JHRHLPFMZZSJKK-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.37 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|