C31H35BCl2FNO6 — CID 166136515
ethyl 2-[2-[2-[[2-chloro-5-[(6-chloro-2-pyridinyl)oxymethyl]phenyl]methoxy]ethyl]-5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (PubChem CID 166136515) has the molecular formula C31H35BCl2FNO6 and a molecular weight of 618.34 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[2-chloro-5-[(6-chloro-2-pyridinyl)oxymethyl]phenyl]methoxy]ethyl]-5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate.
| Compound Name | ethyl 2-[2-[2-[[2-chloro-5-[(6-chloro-2-pyridinyl)oxymethyl]phenyl]methoxy]ethyl]-5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 166136515 |
| Molecular Formula | C31H35BCl2FNO6 |
| Molecular Weight | 618.34 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | ethyl 2-[2-[2-[[2-chloro-5-[(6-chloro-2-pyridinyl)oxymethyl]phenyl]methoxy]ethyl]-5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(F)c(B2OC(C)(C)C(C)(C)O2)cc1CCOCc1cc(COc2cccc(Cl)n2)ccc1Cl |
| InChI | InChI=1S/C31H35BCl2FNO6/c1-6-39-29(37)17-22-16-26(35)24(32-41-30(2,3)31(4,5)42-32)15-21(22)12-13-38-19-23-14-20(10-11-25(23)33)18-40-28-9-7-8-27(34)36-28/h7-11,14-16H,6,12-13,17-19H2,1-5H3 |
| InChIKey | FVPNEKBIAXBZKD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.34 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|