C26H37NO3Si — CID 166137100
2-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]ethanol (PubChem CID 166137100) has the molecular formula C26H37NO3Si and a molecular weight of 439.67 g/mol. Its IUPAC name is 2-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]ethanol.
| Compound Name | 2-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]ethanol |
|---|---|
| PubChem CID | 166137100 |
| Molecular Formula | C26H37NO3Si |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 2-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]ethanol |
| SMILES | CC(C)(C)[Si](OC[C@]12CCCN1C[C@H](OCCO)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H37NO3Si/c1-25(2,3)31(23-11-6-4-7-12-23,24-13-8-5-9-14-24)30-21-26-15-10-16-27(26)20-22(19-26)29-18-17-28/h4-9,11-14,22,28H,10,15-21H2,1-3H3/t22-,26-/m1/s1 |
| InChIKey | HYJYZOFBLATWDD-ATIYNZHBSA-N |
| XLogP | 3.18 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|