C27H39NO3Si — CID 166137180
3-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]propan-1-ol (PubChem CID 166137180) has the molecular formula C27H39NO3Si and a molecular weight of 453.70 g/mol. Its IUPAC name is 3-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]propan-1-ol.
| Compound Name | 3-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 166137180 |
| Molecular Formula | C27H39NO3Si |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 3-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]propan-1-ol |
| SMILES | CC(C)(C)[Si](OC[C@]12CCCN1C[C@H](OCCCO)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H39NO3Si/c1-26(2,3)32(24-12-6-4-7-13-24,25-14-8-5-9-15-25)31-22-27-16-10-17-28(27)21-23(20-27)30-19-11-18-29/h4-9,12-15,23,29H,10-11,16-22H2,1-3H3/t23-,27-/m1/s1 |
| InChIKey | JKFKBPWUPVRPEL-YIXXDRMTSA-N |
| XLogP | 3.57 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|