C32H48N2O4Si — CID 166137321
tert-butyl N-[2-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]ethyl]-N-methylcarbamate (PubChem CID 166137321) has the molecular formula C32H48N2O4Si and a molecular weight of 552.83 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 166137321 |
| Molecular Formula | C32H48N2O4Si |
| Molecular Weight | 552.83 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | tert-butyl N-[2-[[(2R,8R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]ethyl]-N-methylcarbamate |
| SMILES | CN(CCO[C@H]1CN2CCC[C@]2(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H48N2O4Si/c1-30(2,3)38-29(35)33(7)21-22-36-26-23-32(19-14-20-34(32)24-26)25-37-39(31(4,5)6,27-15-10-8-11-16-27)28-17-12-9-13-18-28/h8-13,15-18,26H,14,19-25H2,1-7H3/t26-,32-/m1/s1 |
| InChIKey | DMJSSBGMDBYKCN-HVIPQOSHSA-N |
| XLogP | 5.05 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.83 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|