About 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol
2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol (PubChem CID 166138278) has the molecular formula C33H66O3S4
and a molecular weight of 639.16 g/mol. Its IUPAC name is 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol |
| PubChem CID | 166138278 |
| Molecular Formula | C33H66O3S4 |
| Molecular Weight | 639.16 g/mol |
| Exact Mass | 638.39 |
| IUPAC Name | 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol |
| SMILES | CCCCCSCSCCCCCCCCC1(CCCCCCCCSCSCCCCC)OCC(CCO)O1 |
| InChI | InChI=1S/C33H66O3S4/c1-3-5-17-25-37-30-39-27-19-13-9-7-11-15-22-33(35-29-32(36-33)21-24-34)23-16-12-8-10-14-20-28-40-31-38-26-18-6-4-2/h32,34H,3-31H2,1-2H3 |
| InChIKey | OVNZMBCNZTYRHK-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 639.16 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol?
The IUPAC name of 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol (CID 166138278) is 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol.
What is the SMILES notation for 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol?
The canonical SMILES for 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol is CCCCCSCSCCCCCCCCC1(CCCCCCCCSCSCCCCC)OCC(CCO)O1.
What is the InChIKey of 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol?
The InChIKey is OVNZMBCNZTYRHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H66O3S4/c1-3-5-17-25-37-30-39-27-19-13-9-7-11-15-22-33(35-29-32(36-33)21-24-34)23-16-12-8-10-14-20-28-40-31-38-26-18-6-4-2/h32,34H,3-31H2,1-2H3.
What are the key properties of 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol?
2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol has a molecular weight of 639.16 g/mol, XLogP of 11.17, 32 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethanol is sourced from PubChem (CID 166138278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).