C49H96O5Si2 — CID 166138294
methyl (Z,14R)-14-[tert-butyl(dimethyl)silyl]oxy-2-[(Z,10R)-10-[tert-butyl(dimethyl)silyl]oxyhexadec-7-enyl]-3-oxoicos-11-enoate (PubChem CID 166138294) has the molecular formula C49H96O5Si2 and a molecular weight of 821.47 g/mol. Its IUPAC name is methyl (Z,14R)-14-[tert-butyl(dimethyl)silyl]oxy-2-[(Z,10R)-10-[tert-butyl(dimethyl)silyl]oxyhexadec-7-enyl]-3-oxoicos-11-enoate.
| Compound Name | methyl (Z,14R)-14-[tert-butyl(dimethyl)silyl]oxy-2-[(Z,10R)-10-[tert-butyl(dimethyl)silyl]oxyhexadec-7-enyl]-3-oxoicos-11-enoate |
|---|---|
| PubChem CID | 166138294 |
| Molecular Formula | C49H96O5Si2 |
| Molecular Weight | 821.47 g/mol |
| Exact Mass | 820.68 |
| IUPAC Name | methyl (Z,14R)-14-[tert-butyl(dimethyl)silyl]oxy-2-[(Z,10R)-10-[tert-butyl(dimethyl)silyl]oxyhexadec-7-enyl]-3-oxoicos-11-enoate |
| SMILES | CCCCCC[C@H](C/C=C\CCCCCCCC(=O)C(CCCCCC/C=C\C[C@@H](CCCCCC)O[Si](C)(C)C(C)(C)C)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C49H96O5Si2/c1-14-16-18-31-37-43(53-55(10,11)48(3,4)5)39-33-27-23-20-21-26-30-36-42-46(50)45(47(51)52-9)41-35-29-25-22-24-28-34-40-44(38-32-19-17-15-2)54-56(12,13)49(6,7)8/h27-28,33-34,43-45H,14-26,29-32,35-42H2,1-13H3/b33-27-,34-28-/t43-,44-,45?/m1/s1 |
| InChIKey | IAQKEPRBRAYWNR-QHXFEBMWSA-N |
| XLogP | 16.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.47 |
| LogP ≤ 5 | 16.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|