About 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide
2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide (PubChem CID 16613842) has the molecular formula C21H20N4O2S
and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide |
| PubChem CID | 16613842 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide |
| SMILES | O=C(CC1Sc2ccccc2NC1=O)NCCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H20N4O2S/c26-20(12-19-21(27)24-17-8-4-5-9-18(17)28-19)22-11-10-15-13-23-25(14-15)16-6-2-1-3-7-16/h1-9,13-14,19H,10-12H2,(H,22,26)(H,24,27) |
| InChIKey | YTHOBDZQBMIEQB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide?
The IUPAC name of 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide (CID 16613842) is 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide.
What is the SMILES notation for 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide?
The canonical SMILES for 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide is O=C(CC1Sc2ccccc2NC1=O)NCCc1cnn(-c2ccccc2)c1.
What is the InChIKey of 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide?
The InChIKey is YTHOBDZQBMIEQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O2S/c26-20(12-19-21(27)24-17-8-4-5-9-18(17)28-19)22-11-10-15-13-23-25(14-15)16-6-2-1-3-7-16/h1-9,13-14,19H,10-12H2,(H,22,26)(H,24,27).
What are the key properties of 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide?
2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide has a molecular weight of 392.48 g/mol, XLogP of 3.03, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide is sourced from PubChem (CID 16613842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).