C16H22N2O2 — CID 166138447
7-methyl-7-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-5,6-dihydro-[1,3]dioxolo[4,5-f]indole (PubChem CID 166138447) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 7-methyl-7-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-5,6-dihydro-[1,3]dioxolo[4,5-f]indole.
| Compound Name | 7-methyl-7-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-5,6-dihydro-[1,3]dioxolo[4,5-f]indole |
|---|---|
| PubChem CID | 166138447 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 7-methyl-7-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-5,6-dihydro-[1,3]dioxolo[4,5-f]indole |
| SMILES | CN1CCC[C@@H]1CC1(C)CNc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C16H22N2O2/c1-16(8-11-4-3-5-18(11)2)9-17-13-7-15-14(6-12(13)16)19-10-20-15/h6-7,11,17H,3-5,8-10H2,1-2H3/t11-,16?/m1/s1 |
| InChIKey | FAFYKPLPJHZKIU-ZVDHGWRTSA-N |
| XLogP | 2.58 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|