C16H26N2O3 — CID 166138554
N,N-dimethyl-2-(4,5,6-trimethoxy-3-methyl-1,2-dihydroindol-3-yl)ethanamine (PubChem CID 166138554) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is N,N-dimethyl-2-(4,5,6-trimethoxy-3-methyl-1,2-dihydroindol-3-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(4,5,6-trimethoxy-3-methyl-1,2-dihydroindol-3-yl)ethanamine |
|---|---|
| PubChem CID | 166138554 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N,N-dimethyl-2-(4,5,6-trimethoxy-3-methyl-1,2-dihydroindol-3-yl)ethanamine |
| SMILES | COc1cc2c(c(OC)c1OC)C(C)(CCN(C)C)CN2 |
| InChI | InChI=1S/C16H26N2O3/c1-16(7-8-18(2)3)10-17-11-9-12(19-4)14(20-5)15(21-6)13(11)16/h9,17H,7-8,10H2,1-6H3 |
| InChIKey | GFMDFTHSYISTIM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|