C21H26ClFN6O2S — CID 166138894
tert-butyl (1S,5R)-3-(7-chloro-8-fluoro-11-methylsulfanyl-3,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,7,10,12-pentaen-13-yl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 166138894) has the molecular formula C21H26ClFN6O2S and a molecular weight of 481.00 g/mol. Its IUPAC name is tert-butyl (1S,5R)-3-(7-chloro-8-fluoro-11-methylsulfanyl-3,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,7,10,12-pentaen-13-yl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1S,5R)-3-(7-chloro-8-fluoro-11-methylsulfanyl-3,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,7,10,12-pentaen-13-yl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 166138894 |
| Molecular Formula | C21H26ClFN6O2S |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | tert-butyl (1S,5R)-3-(7-chloro-8-fluoro-11-methylsulfanyl-3,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,7,10,12-pentaen-13-yl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CSc1nc2c(c(N3C[C@H]4CC[C@@H](C3)N4C(=O)OC(C)(C)C)n1)C1=NCCN1C(Cl)=C2F |
| InChI | InChI=1S/C21H26ClFN6O2S/c1-21(2,3)31-20(30)29-11-5-6-12(29)10-27(9-11)18-13-15(25-19(26-18)32-4)14(23)16(22)28-8-7-24-17(13)28/h11-12H,5-10H2,1-4H3/t11-,12+ |
| InChIKey | QIYBSCRBCCUZPM-TXEJJXNPSA-N |
| XLogP | 3.70 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|