C21H26F3N3O3 — CID 166138994
tert-butyl 8-(oxan-4-yl)-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-11-carboxylate (PubChem CID 166138994) has the molecular formula C21H26F3N3O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is tert-butyl 8-(oxan-4-yl)-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-11-carboxylate.
| Compound Name | tert-butyl 8-(oxan-4-yl)-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 166138994 |
| Molecular Formula | C21H26F3N3O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | tert-butyl 8-(oxan-4-yl)-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCn2c(c(C3CCOCC3)c3cc(C(F)(F)F)cnc32)C1 |
| InChI | InChI=1S/C21H26F3N3O3/c1-20(2,3)30-19(28)26-6-7-27-16(12-26)17(13-4-8-29-9-5-13)15-10-14(21(22,23)24)11-25-18(15)27/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | UPKPQHWDADQKFK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |