C11H8F3N3O — CID 166139012
5-(trifluoromethyl)-1,6,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one (PubChem CID 166139012) has the molecular formula C11H8F3N3O and a molecular weight of 255.20 g/mol. Its IUPAC name is 5-(trifluoromethyl)-1,6,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one.
| Compound Name | 5-(trifluoromethyl)-1,6,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one |
|---|---|
| PubChem CID | 166139012 |
| Molecular Formula | C11H8F3N3O |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 5-(trifluoromethyl)-1,6,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one |
| SMILES | O=C1NCCn2c1cc1nc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C11H8F3N3O/c12-11(13,14)9-2-1-7-6(16-9)5-8-10(18)15-3-4-17(7)8/h1-2,5H,3-4H2,(H,15,18) |
| InChIKey | FUDHROHDDWTABG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |