C27H18Cl3N3O2 — CID 166139066
N-(2-aminophenyl)-6-[8-(trichloromethyl)quinolin-4-yl]oxynaphthalene-1-carboxamide (PubChem CID 166139066) has the molecular formula C27H18Cl3N3O2 and a molecular weight of 522.82 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[8-(trichloromethyl)quinolin-4-yl]oxynaphthalene-1-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[8-(trichloromethyl)quinolin-4-yl]oxynaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 166139066 |
| Molecular Formula | C27H18Cl3N3O2 |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | N-(2-aminophenyl)-6-[8-(trichloromethyl)quinolin-4-yl]oxynaphthalene-1-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1cccc2cc(Oc3ccnc4c(C(Cl)(Cl)Cl)cccc34)ccc12 |
| InChI | InChI=1S/C27H18Cl3N3O2/c28-27(29,30)21-8-4-7-20-24(13-14-32-25(20)21)35-17-11-12-18-16(15-17)5-3-6-19(18)26(34)33-23-10-2-1-9-22(23)31/h1-15H,31H2,(H,33,34) |
| InChIKey | AUIHEHBLWMGLES-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|