About 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene
6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene (PubChem CID 166139689) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene.
Molecular Properties
| Compound Name | 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene |
| PubChem CID | 166139689 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene |
| SMILES | C/C(=C/C1=CCC2(CC1)CC2)C(C)C |
| InChI | InChI=1S/C14H22/c1-11(2)12(3)10-13-4-6-14(7-5-13)8-9-14/h4,10-11H,5-9H2,1-3H3/b12-10- |
| InChIKey | QWVRGVJLHLCHPI-BENRWUELSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene?
The IUPAC name of 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene (CID 166139689) is 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene.
What is the SMILES notation for 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene?
The canonical SMILES for 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene is C/C(=C/C1=CCC2(CC1)CC2)C(C)C.
What is the InChIKey of 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene?
The InChIKey is QWVRGVJLHLCHPI-BENRWUELSA-N. The full InChI is InChI=1S/C14H22/c1-11(2)12(3)10-13-4-6-14(7-5-13)8-9-14/h4,10-11H,5-9H2,1-3H3/b12-10-.
What are the key properties of 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene?
6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene has a molecular weight of 190.33 g/mol, XLogP of 4.48, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-2,3-dimethylbut-1-enyl]spiro[2.5]oct-6-ene is sourced from PubChem (CID 166139689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).