About 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane
4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane (PubChem CID 166139905) has the molecular formula C12H11Cl2FN4O
and a molecular weight of 317.15 g/mol. Its IUPAC name is 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane |
| PubChem CID | 166139905 |
| Molecular Formula | C12H11Cl2FN4O |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane |
| SMILES | Fc1c(Cl)ncc2c(N3CCCOCC3)nc(Cl)nc12 |
| InChI | InChI=1S/C12H11Cl2FN4O/c13-10-8(15)9-7(6-16-10)11(18-12(14)17-9)19-2-1-4-20-5-3-19/h6H,1-5H2 |
| InChIKey | NMIOSVKNLMMULM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane?
The IUPAC name of 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane (CID 166139905) is 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane.
What is the SMILES notation for 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane?
The canonical SMILES for 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane is Fc1c(Cl)ncc2c(N3CCCOCC3)nc(Cl)nc12.
What is the InChIKey of 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane?
The InChIKey is NMIOSVKNLMMULM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2FN4O/c13-10-8(15)9-7(6-16-10)11(18-12(14)17-9)19-2-1-4-20-5-3-19/h6H,1-5H2.
What are the key properties of 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane?
4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane has a molecular weight of 317.15 g/mol, XLogP of 2.70, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane is sourced from PubChem (CID 166139905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).