C31H30FN7O2 — CID 166139956
4-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 166139956) has the molecular formula C31H30FN7O2 and a molecular weight of 551.63 g/mol. Its IUPAC name is 4-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | 4-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 166139956 |
| Molecular Formula | C31H30FN7O2 |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 4-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | Oc1cc(-c2ncc3c(N4CCn5ccnc5C4)nc(OCC45CCCN4CCC5)nc3c2F)c2ccccc2c1 |
| InChI | InChI=1S/C31H30FN7O2/c32-26-27(23-16-21(40)15-20-5-1-2-6-22(20)23)34-17-24-28(26)35-30(41-19-31-7-3-10-39(31)11-4-8-31)36-29(24)38-14-13-37-12-9-33-25(37)18-38/h1-2,5-6,9,12,15-17,40H,3-4,7-8,10-11,13-14,18-19H2 |
| InChIKey | GMXQFTOJRHDJNS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |