C20H25ClFN5O2 — CID 166139985
4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,4-oxazepane (PubChem CID 166139985) has the molecular formula C20H25ClFN5O2 and a molecular weight of 421.90 g/mol. Its IUPAC name is 4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,4-oxazepane.
| Compound Name | 4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,4-oxazepane |
|---|---|
| PubChem CID | 166139985 |
| Molecular Formula | C20H25ClFN5O2 |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,4-oxazepane |
| SMILES | Fc1c(Cl)ncc2c(N3CCCOCC3)nc(OCC34CCCN3CCC4)nc12 |
| InChI | InChI=1S/C20H25ClFN5O2/c21-17-15(22)16-14(12-23-17)18(26-6-3-10-28-11-9-26)25-19(24-16)29-13-20-4-1-7-27(20)8-2-5-20/h12H,1-11,13H2 |
| InChIKey | NUKSKYARSCVXCF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|