C29H36FN3O6S2 — CID 166140230
7-[(1S)-1-[[(Z)-4-(1-aminocyclopropyl)-2-methoxybut-1-enyl]-formylamino]ethyl]-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indole-2-carboxylic acid;methanethiol (PubChem CID 166140230) has the molecular formula C29H36FN3O6S2 and a molecular weight of 605.75 g/mol. Its IUPAC name is 7-[(1S)-1-[[(Z)-4-(1-aminocyclopropyl)-2-methoxybut-1-enyl]-formylamino]ethyl]-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indole-2-carboxylic acid;methanethiol.
| Compound Name | 7-[(1S)-1-[[(Z)-4-(1-aminocyclopropyl)-2-methoxybut-1-enyl]-formylamino]ethyl]-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indole-2-carboxylic acid;methanethiol |
|---|---|
| PubChem CID | 166140230 |
| Molecular Formula | C29H36FN3O6S2 |
| Molecular Weight | 605.75 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | 7-[(1S)-1-[[(Z)-4-(1-aminocyclopropyl)-2-methoxybut-1-enyl]-formylamino]ethyl]-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indole-2-carboxylic acid;methanethiol |
| SMILES | CO/C(=C\N(C=O)[C@@H](C)c1cccc2c(-c3ccc(CS(C)(=O)=O)c(F)c3)c(C(=O)O)[nH]c12)CCC1(N)CC1.CS |
| InChI | InChI=1S/C28H32FN3O6S.CH4S/c1-17(32(16-33)14-20(38-2)9-10-28(30)11-12-28)21-5-4-6-22-24(26(27(34)35)31-25(21)22)18-7-8-19(23(29)13-18)15-39(3,36)37;1-2/h4-8,13-14,16-17,31H,9-12,15,30H2,1-3H3,(H,34,35);2H,1H3/b20-14-;/t17-;/m0./s1 |
| InChIKey | BWXSCFRGGYXOQJ-DTYVPALASA-N |
| XLogP | 5.04 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|