About CID 166140480
CID 166140480 (PubChem CID 166140480) has the molecular formula C32H29B6ClF3N9O7
and a molecular weight of 808.96 g/mol.
Molecular Properties
| Compound Name | CID 166140480 |
| PubChem CID | 166140480 |
| Molecular Formula | C32H29B6ClF3N9O7 |
| Molecular Weight | 808.96 g/mol |
| Exact Mass | 809.24 |
| IUPAC Name | — |
| SMILES | [B]C.[B]C1N(C(=O)c2ncnc(C)c2O)C([B])(O)C([B])(O)N(c2c(CC)n(CC(=O)Nc3ccc(C(F)(F)F)cc3Cl)c3nc(C4=CCOCC4)nn3c2=O)C1([B])[B] |
| InChI | InChI=1S/C31H26B5ClF3N9O7.CH3B/c1-3-18-21(49-28(33,34)26(32)47(30(35,54)31(49,36)55)24(52)20-22(51)13(2)41-12-42-20)25(53)48-27(44-23(45-48)14-6-8-56-9-7-14)46(18)11-19(50)43-17-5-4-15(10-16(17)37)29(38,39)40;1-2/h4-6,10,12,26,51,54-55H,3,7-9,11H2,1-2H3,(H,43,50);1H3 |
| InChIKey | VAMYFTCKYNAWID-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 200.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 808.96 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 166140480 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166140480?
The IUPAC name of CID 166140480 (CID 166140480) is not available.
What is the SMILES notation for CID 166140480?
The canonical SMILES for CID 166140480 is [B]C.[B]C1N(C(=O)c2ncnc(C)c2O)C([B])(O)C([B])(O)N(c2c(CC)n(CC(=O)Nc3ccc(C(F)(F)F)cc3Cl)c3nc(C4=CCOCC4)nn3c2=O)C1([B])[B].
What is the InChIKey of CID 166140480?
The InChIKey is VAMYFTCKYNAWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H26B5ClF3N9O7.CH3B/c1-3-18-21(49-28(33,34)26(32)47(30(35,54)31(49,36)55)24(52)20-22(51)13(2)41-12-42-20)25(53)48-27(44-23(45-48)14-6-8-56-9-7-14)46(18)11-19(50)43-17-5-4-15(10-16(17)37)29(38,39)40;1-2/h4-6,10,12,26,51,54-55H,3,7-9,11H2,1-2H3,(H,43,50);1H3.
What are the key properties of CID 166140480?
CID 166140480 has a molecular weight of 808.96 g/mol, XLogP of -0.35, 7 rotatable bonds, 4 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166140480 is sourced from PubChem (CID 166140480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).